About 9-methyl-6H-pyrrolo[2,3-f]quinoline
9-methyl-6H-pyrrolo[2,3-f]quinoline (PubChem CID 171904722) has the molecular formula C12H10N2
and a molecular weight of 182.23 g/mol. Its IUPAC name is 9-methyl-6H-pyrrolo[2,3-f]quinoline.
Molecular Properties
| Compound Name | 9-methyl-6H-pyrrolo[2,3-f]quinoline |
| PubChem CID | 171904722 |
| Molecular Formula | C12H10N2 |
| Molecular Weight | 182.23 g/mol |
| Exact Mass | 182.08 |
| IUPAC Name | 9-methyl-6H-pyrrolo[2,3-f]quinoline |
| SMILES | Cc1cc[nH]c2ccc3ccnc3c12 |
| InChI | InChI=1S/C12H10N2/c1-8-4-6-13-10-3-2-9-5-7-14-12(9)11(8)10/h2-7,13H,1H3 |
| InChIKey | NCBGBEMJVSROMD-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.23 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 9-methyl-6H-pyrrolo[2,3-f]quinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-methyl-6H-pyrrolo[2,3-f]quinoline?
The IUPAC name of 9-methyl-6H-pyrrolo[2,3-f]quinoline (CID 171904722) is 9-methyl-6H-pyrrolo[2,3-f]quinoline.
What is the SMILES notation for 9-methyl-6H-pyrrolo[2,3-f]quinoline?
The canonical SMILES for 9-methyl-6H-pyrrolo[2,3-f]quinoline is Cc1cc[nH]c2ccc3ccnc3c12.
What is the InChIKey of 9-methyl-6H-pyrrolo[2,3-f]quinoline?
The InChIKey is NCBGBEMJVSROMD-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10N2/c1-8-4-6-13-10-3-2-9-5-7-14-12(9)11(8)10/h2-7,13H,1H3.
What are the key properties of 9-methyl-6H-pyrrolo[2,3-f]quinoline?
9-methyl-6H-pyrrolo[2,3-f]quinoline has a molecular weight of 182.23 g/mol, XLogP of 3.02, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 9-methyl-6H-pyrrolo[2,3-f]quinoline is sourced from PubChem (CID 171904722), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).