C33H50N2O — CID 171905018
3-[[(1R,4aS,10aR)-1,4a-dimethyl-7-propan-2-yl-2,3,4,9,10,10a-hexahydrophenanthren-1-yl]methylamino]-N-(1-adamantyl)propanamide (PubChem CID 171905018) has the molecular formula C33H50N2O and a molecular weight of 490.78 g/mol. Its IUPAC name is 3-[[(1R,4aS,10aR)-1,4a-dimethyl-7-propan-2-yl-2,3,4,9,10,10a-hexahydrophenanthren-1-yl]methylamino]-N-(1-adamantyl)propanamide.
| Compound Name | 3-[[(1R,4aS,10aR)-1,4a-dimethyl-7-propan-2-yl-2,3,4,9,10,10a-hexahydrophenanthren-1-yl]methylamino]-N-(1-adamantyl)propanamide |
|---|---|
| PubChem CID | 171905018 |
| Molecular Formula | C33H50N2O |
| Molecular Weight | 490.78 g/mol |
| Exact Mass | 490.39 |
| IUPAC Name | 3-[[(1R,4aS,10aR)-1,4a-dimethyl-7-propan-2-yl-2,3,4,9,10,10a-hexahydrophenanthren-1-yl]methylamino]-N-(1-adamantyl)propanamide |
| SMILES | CC(C)c1ccc2c(c1)CC[C@H]1[C@](C)(CNCCC(=O)NC34CC5CC(CC(C5)C3)C4)CCC[C@]21C |
| InChI | InChI=1S/C33H50N2O/c1-22(2)26-6-8-28-27(17-26)7-9-29-31(3,11-5-12-32(28,29)4)21-34-13-10-30(36)35-33-18-23-14-24(19-33)16-25(15-23)20-33/h6,8,17,22-25,29,34H,5,7,9-16,18-21H2,1-4H3,(H,35,36)/t23?,24?,25?,29-,31-,32+,33?/m0/s1 |
| InChIKey | JZSYCUPQGSEOAJ-HRBOZBNGSA-N |
| XLogP | 6.89 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.78 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|