C19H25BF3NO3 — CID 171905793
(4,4-difluoropiperidin-1-yl)-[2-fluoro-5-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methanone (PubChem CID 171905793) has the molecular formula C19H25BF3NO3 and a molecular weight of 383.22 g/mol. Its IUPAC name is (4,4-difluoropiperidin-1-yl)-[2-fluoro-5-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methanone.
| Compound Name | (4,4-difluoropiperidin-1-yl)-[2-fluoro-5-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methanone |
|---|---|
| PubChem CID | 171905793 |
| Molecular Formula | C19H25BF3NO3 |
| Molecular Weight | 383.22 g/mol |
| Exact Mass | 383.19 |
| IUPAC Name | (4,4-difluoropiperidin-1-yl)-[2-fluoro-5-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methanone |
| SMILES | Cc1cc(C(=O)N2CCC(F)(F)CC2)c(F)cc1B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C19H25BF3NO3/c1-12-10-13(16(25)24-8-6-19(22,23)7-9-24)15(21)11-14(12)20-26-17(2,3)18(4,5)27-20/h10-11H,6-9H2,1-5H3 |
| InChIKey | LDDHYKJOXHIKAK-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.22 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|