C10H12O — CID 171905891
1,4,5,8-tetrahydronaphthalen-2-ol (PubChem CID 171905891) has the molecular formula C10H12O and a molecular weight of 148.21 g/mol. Its IUPAC name is 1,4,5,8-tetrahydronaphthalen-2-ol.
| Compound Name | 1,4,5,8-tetrahydronaphthalen-2-ol |
|---|---|
| PubChem CID | 171905891 |
| Molecular Formula | C10H12O |
| Molecular Weight | 148.21 g/mol |
| Exact Mass | 148.09 |
| IUPAC Name | 1,4,5,8-tetrahydronaphthalen-2-ol |
| SMILES | OC1=CCC2=C(CC=CC2)C1 |
| InChI | InChI=1S/C10H12O/c11-10-6-5-8-3-1-2-4-9(8)7-10/h1-2,6,11H,3-5,7H2 |
| InChIKey | RAWMFZVICQZPAS-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 148.21 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|