C12H17BrFN — CID 171906163
N-[(4-bromo-2-fluoro-5-methylphenyl)methyl]-2-methylpropan-1-amine (PubChem CID 171906163) has the molecular formula C12H17BrFN and a molecular weight of 274.18 g/mol. Its IUPAC name is N-[(4-bromo-2-fluoro-5-methylphenyl)methyl]-2-methylpropan-1-amine.
| Compound Name | N-[(4-bromo-2-fluoro-5-methylphenyl)methyl]-2-methylpropan-1-amine |
|---|---|
| PubChem CID | 171906163 |
| Molecular Formula | C12H17BrFN |
| Molecular Weight | 274.18 g/mol |
| Exact Mass | 273.05 |
| IUPAC Name | N-[(4-bromo-2-fluoro-5-methylphenyl)methyl]-2-methylpropan-1-amine |
| SMILES | Cc1cc(CNCC(C)C)c(F)cc1Br |
| InChI | InChI=1S/C12H17BrFN/c1-8(2)6-15-7-10-4-9(3)11(13)5-12(10)14/h4-5,8,15H,6-7H2,1-3H3 |
| InChIKey | NCVQDAZROYHNTG-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.18 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |