C22H23N3O3 — CID 171906544
4-[2-(2-tert-butyl-5,7-dihydropyrrolo[3,4-d]pyrimidin-6-yl)-2-oxoethyl]-7-methylchromen-2-one (PubChem CID 171906544) has the molecular formula C22H23N3O3 and a molecular weight of 377.44 g/mol. Its IUPAC name is 4-[2-(2-tert-butyl-5,7-dihydropyrrolo[3,4-d]pyrimidin-6-yl)-2-oxoethyl]-7-methylchromen-2-one.
| Compound Name | 4-[2-(2-tert-butyl-5,7-dihydropyrrolo[3,4-d]pyrimidin-6-yl)-2-oxoethyl]-7-methylchromen-2-one |
|---|---|
| PubChem CID | 171906544 |
| Molecular Formula | C22H23N3O3 |
| Molecular Weight | 377.44 g/mol |
| Exact Mass | 377.17 |
| IUPAC Name | 4-[2-(2-tert-butyl-5,7-dihydropyrrolo[3,4-d]pyrimidin-6-yl)-2-oxoethyl]-7-methylchromen-2-one |
| SMILES | Cc1ccc2c(CC(=O)N3Cc4cnc(C(C)(C)C)nc4C3)cc(=O)oc2c1 |
| InChI | InChI=1S/C22H23N3O3/c1-13-5-6-16-14(9-20(27)28-18(16)7-13)8-19(26)25-11-15-10-23-21(22(2,3)4)24-17(15)12-25/h5-7,9-10H,8,11-12H2,1-4H3 |
| InChIKey | BSLMPFAQDWXXGI-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 76.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.44 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|