C22H22N6O2 — CID 171906916
(1R,8R,9S)-8-(2,5-dihydropyrrole-1-carbonyl)-11-imidazo[1,2-b]pyridazin-6-yl-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-6-one (PubChem CID 171906916) has the molecular formula C22H22N6O2 and a molecular weight of 402.46 g/mol. Its IUPAC name is (1R,8R,9S)-8-(2,5-dihydropyrrole-1-carbonyl)-11-imidazo[1,2-b]pyridazin-6-yl-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-6-one.
| Compound Name | (1R,8R,9S)-8-(2,5-dihydropyrrole-1-carbonyl)-11-imidazo[1,2-b]pyridazin-6-yl-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-6-one |
|---|---|
| PubChem CID | 171906916 |
| Molecular Formula | C22H22N6O2 |
| Molecular Weight | 402.46 g/mol |
| Exact Mass | 402.18 |
| IUPAC Name | (1R,8R,9S)-8-(2,5-dihydropyrrole-1-carbonyl)-11-imidazo[1,2-b]pyridazin-6-yl-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-6-one |
| SMILES | O=C([C@H]1[C@H]2C[C@H](CN(c3ccc4nccn4n3)C2)c2cccc(=O)n21)N1CC=CC1 |
| InChI | InChI=1S/C22H22N6O2/c29-20-5-3-4-17-15-12-16(21(28(17)20)22(30)25-9-1-2-10-25)14-26(13-15)19-7-6-18-23-8-11-27(18)24-19/h1-8,11,15-16,21H,9-10,12-14H2/t15-,16+,21-/m1/s1 |
| InChIKey | CYWTXMFGVKWDMA-VWKPWSFCSA-N |
| XLogP | 1.45 |
| TPSA | 75.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.46 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|