C23H29N3O3 — CID 171908279
[(3aR,4R,6aS)-2-(cyclobutylmethyl)-4-(4-methoxyphenyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-(2-methyl-1,3-oxazol-4-yl)methanone (PubChem CID 171908279) has the molecular formula C23H29N3O3 and a molecular weight of 395.50 g/mol. Its IUPAC name is [(3aR,4R,6aS)-2-(cyclobutylmethyl)-4-(4-methoxyphenyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-(2-methyl-1,3-oxazol-4-yl)methanone.
| Compound Name | [(3aR,4R,6aS)-2-(cyclobutylmethyl)-4-(4-methoxyphenyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-(2-methyl-1,3-oxazol-4-yl)methanone |
|---|---|
| PubChem CID | 171908279 |
| Molecular Formula | C23H29N3O3 |
| Molecular Weight | 395.50 g/mol |
| Exact Mass | 395.22 |
| IUPAC Name | [(3aR,4R,6aS)-2-(cyclobutylmethyl)-4-(4-methoxyphenyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-(2-methyl-1,3-oxazol-4-yl)methanone |
| SMILES | COc1ccc([C@H]2[C@H]3CN(CC4CCC4)C[C@H]3CN2C(=O)c2coc(C)n2)cc1 |
| InChI | InChI=1S/C23H29N3O3/c1-15-24-21(14-29-15)23(27)26-12-18-11-25(10-16-4-3-5-16)13-20(18)22(26)17-6-8-19(28-2)9-7-17/h6-9,14,16,18,20,22H,3-5,10-13H2,1-2H3/t18-,20-,22-/m0/s1 |
| InChIKey | WSHMBDPIEMCICB-VCOUNFBDSA-N |
| XLogP | 3.54 |
| TPSA | 58.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.50 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |