C24H25NO5 — CID 171911013
N-[2-(2-hydroxyethyl)phenyl]-2-[(6-methyl-4-oxo-2,3-dihydro-1H-cyclopenta[c]chromen-7-yl)oxy]propanamide (PubChem CID 171911013) has the molecular formula C24H25NO5 and a molecular weight of 407.47 g/mol. Its IUPAC name is N-[2-(2-hydroxyethyl)phenyl]-2-[(6-methyl-4-oxo-2,3-dihydro-1H-cyclopenta[c]chromen-7-yl)oxy]propanamide.
| Compound Name | N-[2-(2-hydroxyethyl)phenyl]-2-[(6-methyl-4-oxo-2,3-dihydro-1H-cyclopenta[c]chromen-7-yl)oxy]propanamide |
|---|---|
| PubChem CID | 171911013 |
| Molecular Formula | C24H25NO5 |
| Molecular Weight | 407.47 g/mol |
| Exact Mass | 407.17 |
| IUPAC Name | N-[2-(2-hydroxyethyl)phenyl]-2-[(6-methyl-4-oxo-2,3-dihydro-1H-cyclopenta[c]chromen-7-yl)oxy]propanamide |
| SMILES | Cc1c(OC(C)C(=O)Nc2ccccc2CCO)ccc2c3c(c(=O)oc12)CCC3 |
| InChI | InChI=1S/C24H25NO5/c1-14-21(11-10-18-17-7-5-8-19(17)24(28)30-22(14)18)29-15(2)23(27)25-20-9-4-3-6-16(20)12-13-26/h3-4,6,9-11,15,26H,5,7-8,12-13H2,1-2H3,(H,25,27) |
| InChIKey | ZIROWZWNCUMSCL-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 88.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.47 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|