C11H18N2OS — CID 17191161
N-(4,5-dimethyl-1,3-thiazol-2-yl)-3,3-dimethylbutanamide (PubChem CID 17191161) has the molecular formula C11H18N2OS and a molecular weight of 226.34 g/mol. Its IUPAC name is N-(4,5-dimethyl-1,3-thiazol-2-yl)-3,3-dimethylbutanamide.
| Compound Name | N-(4,5-dimethyl-1,3-thiazol-2-yl)-3,3-dimethylbutanamide |
|---|---|
| PubChem CID | 17191161 |
| Molecular Formula | C11H18N2OS |
| Molecular Weight | 226.34 g/mol |
| Exact Mass | 226.11 |
| IUPAC Name | N-(4,5-dimethyl-1,3-thiazol-2-yl)-3,3-dimethylbutanamide |
| SMILES | Cc1nc(NC(=O)CC(C)(C)C)sc1C |
| InChI | InChI=1S/C11H18N2OS/c1-7-8(2)15-10(12-7)13-9(14)6-11(3,4)5/h6H2,1-5H3,(H,12,13,14) |
| InChIKey | UXHXSHJSKBVQJV-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.34 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |