C21H27ClN4O3 — CID 171911993
(1R,2S,8R,9S)-11-(5-chloro-2-pyridinyl)-8-(morpholine-4-carbonyl)-7,11-diazatricyclo[7.3.1.02,7]tridecan-6-one (PubChem CID 171911993) has the molecular formula C21H27ClN4O3 and a molecular weight of 418.93 g/mol. Its IUPAC name is (1R,2S,8R,9S)-11-(5-chloro-2-pyridinyl)-8-(morpholine-4-carbonyl)-7,11-diazatricyclo[7.3.1.02,7]tridecan-6-one.
| Compound Name | (1R,2S,8R,9S)-11-(5-chloro-2-pyridinyl)-8-(morpholine-4-carbonyl)-7,11-diazatricyclo[7.3.1.02,7]tridecan-6-one |
|---|---|
| PubChem CID | 171911993 |
| Molecular Formula | C21H27ClN4O3 |
| Molecular Weight | 418.93 g/mol |
| Exact Mass | 418.18 |
| IUPAC Name | (1R,2S,8R,9S)-11-(5-chloro-2-pyridinyl)-8-(morpholine-4-carbonyl)-7,11-diazatricyclo[7.3.1.02,7]tridecan-6-one |
| SMILES | O=C([C@H]1[C@H]2C[C@H](CN(c3ccc(Cl)cn3)C2)[C@@H]2CCCC(=O)N21)N1CCOCC1 |
| InChI | InChI=1S/C21H27ClN4O3/c22-16-4-5-18(23-11-16)25-12-14-10-15(13-25)20(21(28)24-6-8-29-9-7-24)26-17(14)2-1-3-19(26)27/h4-5,11,14-15,17,20H,1-3,6-10,12-13H2/t14-,15+,17+,20-/m1/s1 |
| InChIKey | BEISGJQXLOSOBB-TXDAXLQXSA-N |
| XLogP | 1.80 |
| TPSA | 65.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.93 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |