About 4-chloro-1-(2,2-diethoxyethyl)-3-(trifluoromethyl)pyrazole
4-chloro-1-(2,2-diethoxyethyl)-3-(trifluoromethyl)pyrazole (PubChem CID 17191223) has the molecular formula C10H14ClF3N2O2
and a molecular weight of 286.68 g/mol. Its IUPAC name is 4-chloro-1-(2,2-diethoxyethyl)-3-(trifluoromethyl)pyrazole.
Molecular Properties
| Compound Name | 4-chloro-1-(2,2-diethoxyethyl)-3-(trifluoromethyl)pyrazole |
| PubChem CID | 17191223 |
| Molecular Formula | C10H14ClF3N2O2 |
| Molecular Weight | 286.68 g/mol |
| Exact Mass | 286.07 |
| IUPAC Name | 4-chloro-1-(2,2-diethoxyethyl)-3-(trifluoromethyl)pyrazole |
| SMILES | CCOC(Cn1cc(Cl)c(C(F)(F)F)n1)OCC |
| InChI | InChI=1S/C10H14ClF3N2O2/c1-3-17-8(18-4-2)6-16-5-7(11)9(15-16)10(12,13)14/h5,8H,3-4,6H2,1-2H3 |
| InChIKey | XLSARAZRBVBQLD-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 36.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.68 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 4-chloro-1-(2,2-diethoxyethyl)-3-(trifluoromethyl)pyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-1-(2,2-diethoxyethyl)-3-(trifluoromethyl)pyrazole?
The IUPAC name of 4-chloro-1-(2,2-diethoxyethyl)-3-(trifluoromethyl)pyrazole (CID 17191223) is 4-chloro-1-(2,2-diethoxyethyl)-3-(trifluoromethyl)pyrazole.
What is the SMILES notation for 4-chloro-1-(2,2-diethoxyethyl)-3-(trifluoromethyl)pyrazole?
The canonical SMILES for 4-chloro-1-(2,2-diethoxyethyl)-3-(trifluoromethyl)pyrazole is CCOC(Cn1cc(Cl)c(C(F)(F)F)n1)OCC.
What is the InChIKey of 4-chloro-1-(2,2-diethoxyethyl)-3-(trifluoromethyl)pyrazole?
The InChIKey is XLSARAZRBVBQLD-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14ClF3N2O2/c1-3-17-8(18-4-2)6-16-5-7(11)9(15-16)10(12,13)14/h5,8H,3-4,6H2,1-2H3.
What are the key properties of 4-chloro-1-(2,2-diethoxyethyl)-3-(trifluoromethyl)pyrazole?
4-chloro-1-(2,2-diethoxyethyl)-3-(trifluoromethyl)pyrazole has a molecular weight of 286.68 g/mol, XLogP of 2.95, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-1-(2,2-diethoxyethyl)-3-(trifluoromethyl)pyrazole is sourced from PubChem (CID 17191223), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).