C22H25N3S — CID 171913174
4-[2-(4-benzhydrylpiperazin-1-yl)ethyl]-1,3-thiazole (PubChem CID 171913174) has the molecular formula C22H25N3S and a molecular weight of 363.53 g/mol. Its IUPAC name is 4-[2-(4-benzhydrylpiperazin-1-yl)ethyl]-1,3-thiazole.
| Compound Name | 4-[2-(4-benzhydrylpiperazin-1-yl)ethyl]-1,3-thiazole |
|---|---|
| PubChem CID | 171913174 |
| Molecular Formula | C22H25N3S |
| Molecular Weight | 363.53 g/mol |
| Exact Mass | 363.18 |
| IUPAC Name | 4-[2-(4-benzhydrylpiperazin-1-yl)ethyl]-1,3-thiazole |
| SMILES | c1ccc(C(c2ccccc2)N2CCN(CCc3cscn3)CC2)cc1 |
| InChI | InChI=1S/C22H25N3S/c1-3-7-19(8-4-1)22(20-9-5-2-6-10-20)25-15-13-24(14-16-25)12-11-21-17-26-18-23-21/h1-10,17-18,22H,11-16H2 |
| InChIKey | LJMYLHBUDGXYHA-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 19.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.53 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |