C26H32N2O — CID 171913555
[(3aR,4S,6aS)-2-(cyclohexylmethyl)-4-phenyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-phenylmethanone (PubChem CID 171913555) has the molecular formula C26H32N2O and a molecular weight of 388.56 g/mol. Its IUPAC name is [(3aR,4S,6aS)-2-(cyclohexylmethyl)-4-phenyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-phenylmethanone.
| Compound Name | [(3aR,4S,6aS)-2-(cyclohexylmethyl)-4-phenyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-phenylmethanone |
|---|---|
| PubChem CID | 171913555 |
| Molecular Formula | C26H32N2O |
| Molecular Weight | 388.56 g/mol |
| Exact Mass | 388.25 |
| IUPAC Name | [(3aR,4S,6aS)-2-(cyclohexylmethyl)-4-phenyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-phenylmethanone |
| SMILES | O=C(c1ccccc1)N1C[C@@H]2CN(CC3CCCCC3)C[C@@H]2[C@H]1c1ccccc1 |
| InChI | InChI=1S/C26H32N2O/c29-26(22-14-8-3-9-15-22)28-18-23-17-27(16-20-10-4-1-5-11-20)19-24(23)25(28)21-12-6-2-7-13-21/h2-3,6-9,12-15,20,23-25H,1,4-5,10-11,16-19H2/t23-,24-,25+/m0/s1 |
| InChIKey | GWPXXLOHBIHTCO-CCDWMCETSA-N |
| XLogP | 5.01 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.56 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |