C19H21N3O4 — CID 171913823
2-(1-cyclohexyl-3,6-dioxo-2,4,5,7-tetrahydropyrazolo[3,4-b]pyridin-4-yl)benzoic acid (PubChem CID 171913823) has the molecular formula C19H21N3O4 and a molecular weight of 355.39 g/mol. Its IUPAC name is 2-(1-cyclohexyl-3,6-dioxo-2,4,5,7-tetrahydropyrazolo[3,4-b]pyridin-4-yl)benzoic acid.
| Compound Name | 2-(1-cyclohexyl-3,6-dioxo-2,4,5,7-tetrahydropyrazolo[3,4-b]pyridin-4-yl)benzoic acid |
|---|---|
| PubChem CID | 171913823 |
| Molecular Formula | C19H21N3O4 |
| Molecular Weight | 355.39 g/mol |
| Exact Mass | 355.15 |
| IUPAC Name | 2-(1-cyclohexyl-3,6-dioxo-2,4,5,7-tetrahydropyrazolo[3,4-b]pyridin-4-yl)benzoic acid |
| SMILES | O=C1CC(c2ccccc2C(=O)O)c2c(n(C3CCCCC3)[nH]c2=O)N1 |
| InChI | InChI=1S/C19H21N3O4/c23-15-10-14(12-8-4-5-9-13(12)19(25)26)16-17(20-15)22(21-18(16)24)11-6-2-1-3-7-11/h4-5,8-9,11,14H,1-3,6-7,10H2,(H,20,23)(H,21,24)(H,25,26) |
| InChIKey | MGZTYHUKWCSSHO-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 104.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.39 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |