C19H18N4O3 — CID 171914668
4-[4-methyl-7-(2-methyl-5-oxopyrrolidin-1-yl)quinolin-2-yl]-1H-pyrazole-5-carboxylic acid (PubChem CID 171914668) has the molecular formula C19H18N4O3 and a molecular weight of 350.38 g/mol. Its IUPAC name is 4-[4-methyl-7-(2-methyl-5-oxopyrrolidin-1-yl)quinolin-2-yl]-1H-pyrazole-5-carboxylic acid.
| Compound Name | 4-[4-methyl-7-(2-methyl-5-oxopyrrolidin-1-yl)quinolin-2-yl]-1H-pyrazole-5-carboxylic acid |
|---|---|
| PubChem CID | 171914668 |
| Molecular Formula | C19H18N4O3 |
| Molecular Weight | 350.38 g/mol |
| Exact Mass | 350.14 |
| IUPAC Name | 4-[4-methyl-7-(2-methyl-5-oxopyrrolidin-1-yl)quinolin-2-yl]-1H-pyrazole-5-carboxylic acid |
| SMILES | Cc1cc(-c2cn[nH]c2C(=O)O)nc2cc(N3C(=O)CCC3C)ccc12 |
| InChI | InChI=1S/C19H18N4O3/c1-10-7-15(14-9-20-22-18(14)19(25)26)21-16-8-12(4-5-13(10)16)23-11(2)3-6-17(23)24/h4-5,7-9,11H,3,6H2,1-2H3,(H,20,22)(H,25,26) |
| InChIKey | LOMDQKORARFLDP-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 99.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.38 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |