C18H21F2N3O2S — CID 171915077
3-[5-(3,3-difluoropiperidin-1-yl)sulfonyl-2,4-dimethylphenyl]pyridin-4-amine (PubChem CID 171915077) has the molecular formula C18H21F2N3O2S and a molecular weight of 381.45 g/mol. Its IUPAC name is 3-[5-(3,3-difluoropiperidin-1-yl)sulfonyl-2,4-dimethylphenyl]pyridin-4-amine.
| Compound Name | 3-[5-(3,3-difluoropiperidin-1-yl)sulfonyl-2,4-dimethylphenyl]pyridin-4-amine |
|---|---|
| PubChem CID | 171915077 |
| Molecular Formula | C18H21F2N3O2S |
| Molecular Weight | 381.45 g/mol |
| Exact Mass | 381.13 |
| IUPAC Name | 3-[5-(3,3-difluoropiperidin-1-yl)sulfonyl-2,4-dimethylphenyl]pyridin-4-amine |
| SMILES | Cc1cc(C)c(S(=O)(=O)N2CCCC(F)(F)C2)cc1-c1cnccc1N |
| InChI | InChI=1S/C18H21F2N3O2S/c1-12-8-13(2)17(9-14(12)15-10-22-6-4-16(15)21)26(24,25)23-7-3-5-18(19,20)11-23/h4,6,8-10H,3,5,7,11H2,1-2H3,(H2,21,22) |
| InChIKey | YFUNSOWRZJWBAP-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 76.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.45 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |