C20H23N5O4 — CID 171915843
6,7,8-trimethoxy-3-(1-pyridazin-3-ylpiperidin-4-yl)quinazolin-4-one (PubChem CID 171915843) has the molecular formula C20H23N5O4 and a molecular weight of 397.44 g/mol. Its IUPAC name is 6,7,8-trimethoxy-3-(1-pyridazin-3-ylpiperidin-4-yl)quinazolin-4-one.
| Compound Name | 6,7,8-trimethoxy-3-(1-pyridazin-3-ylpiperidin-4-yl)quinazolin-4-one |
|---|---|
| PubChem CID | 171915843 |
| Molecular Formula | C20H23N5O4 |
| Molecular Weight | 397.44 g/mol |
| Exact Mass | 397.18 |
| IUPAC Name | 6,7,8-trimethoxy-3-(1-pyridazin-3-ylpiperidin-4-yl)quinazolin-4-one |
| SMILES | COc1cc2c(=O)n(C3CCN(c4cccnn4)CC3)cnc2c(OC)c1OC |
| InChI | InChI=1S/C20H23N5O4/c1-27-15-11-14-17(19(29-3)18(15)28-2)21-12-25(20(14)26)13-6-9-24(10-7-13)16-5-4-8-22-23-16/h4-5,8,11-13H,6-7,9-10H2,1-3H3 |
| InChIKey | BLWPNFDWQRZRAP-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 91.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.44 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |