C23H26ClN3O3 — CID 17191849
4-[4-(3-chlorophenyl)piperazine-1-carbonyl]-1-(2-methoxy-5-methylphenyl)pyrrolidin-2-one (PubChem CID 17191849) has the molecular formula C23H26ClN3O3 and a molecular weight of 427.93 g/mol. Its IUPAC name is 4-[4-(3-chlorophenyl)piperazine-1-carbonyl]-1-(2-methoxy-5-methylphenyl)pyrrolidin-2-one.
| Compound Name | 4-[4-(3-chlorophenyl)piperazine-1-carbonyl]-1-(2-methoxy-5-methylphenyl)pyrrolidin-2-one |
|---|---|
| PubChem CID | 17191849 |
| Molecular Formula | C23H26ClN3O3 |
| Molecular Weight | 427.93 g/mol |
| Exact Mass | 427.17 |
| IUPAC Name | 4-[4-(3-chlorophenyl)piperazine-1-carbonyl]-1-(2-methoxy-5-methylphenyl)pyrrolidin-2-one |
| SMILES | COc1ccc(C)cc1N1CC(C(=O)N2CCN(c3cccc(Cl)c3)CC2)CC1=O |
| InChI | InChI=1S/C23H26ClN3O3/c1-16-6-7-21(30-2)20(12-16)27-15-17(13-22(27)28)23(29)26-10-8-25(9-11-26)19-5-3-4-18(24)14-19/h3-7,12,14,17H,8-11,13,15H2,1-2H3 |
| InChIKey | OVJWKGHWWYRVFA-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 53.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.93 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |