C10H11NO3 — CID 171919100
3,6,6-trimethyl-7H-2,1-benzoxazole-4,5-dione (PubChem CID 171919100) has the molecular formula C10H11NO3 and a molecular weight of 193.20 g/mol. Its IUPAC name is 3,6,6-trimethyl-7H-2,1-benzoxazole-4,5-dione.
| Compound Name | 3,6,6-trimethyl-7H-2,1-benzoxazole-4,5-dione |
|---|---|
| PubChem CID | 171919100 |
| Molecular Formula | C10H11NO3 |
| Molecular Weight | 193.20 g/mol |
| Exact Mass | 193.07 |
| IUPAC Name | 3,6,6-trimethyl-7H-2,1-benzoxazole-4,5-dione |
| SMILES | Cc1onc2c1C(=O)C(=O)C(C)(C)C2 |
| InChI | InChI=1S/C10H11NO3/c1-5-7-6(11-14-5)4-10(2,3)9(13)8(7)12/h4H2,1-3H3 |
| InChIKey | FQVFSNONOMOHLB-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 60.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.20 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|