(1R)-2-azoniabicyclo[2.2.1]heptane chloride

C6H12ClN — CID 171919322

IUPAC(1R)-2-azoniabicyclo[2.2.1]heptane chloride
SMILESC1C[C@@H]2CC1C[NH2+]2.[Cl-]
InChIInChI=1S/C6H11N.ClH/c1-2-6-3-5(1)4-7-6;/h5-7H,1-4H2;1H/t5?,6-;/m1./s1
InChIKeyYHUFGQLJZGRCCX-QFWZMSBNSA-N
MW133.62 g/mol
LogP-3.26
Rot. Bonds

About (1R)-2-azoniabicyclo[2.2.1]heptane chloride

(1R)-2-azoniabicyclo[2.2.1]heptane chloride (PubChem CID 171919322) has the molecular formula C6H12ClN and a molecular weight of 133.62 g/mol. Its IUPAC name is (1R)-2-azoniabicyclo[2.2.1]heptane chloride.

Molecular Properties

Compound Name(1R)-2-azoniabicyclo[2.2.1]heptane chloride
PubChem CID171919322
Molecular FormulaC6H12ClN
Molecular Weight133.62 g/mol
Exact Mass133.07
IUPAC Name(1R)-2-azoniabicyclo[2.2.1]heptane chloride
SMILESC1C[C@@H]2CC1C[NH2+]2.[Cl-]
InChIInChI=1S/C6H11N.ClH/c1-2-6-3-5(1)4-7-6;/h5-7H,1-4H2;1H/t5?,6-;/m1./s1
InChIKeyYHUFGQLJZGRCCX-QFWZMSBNSA-N
XLogP-3.26
TPSA16.61 Ų
H-Bond Donors1
H-Bond Acceptors
Rotatable Bonds
Heavy Atoms8
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500133.62
LogP ≤ 5-3.26
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 100

Analyze (1R)-2-azoniabicyclo[2.2.1]heptane chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

2-Azabicyclo(2.2.1)heptane
CID 78963
2-Azabicyclo[2.2.1]heptane hydrochloride
CID 20070801
6,6-Difluoro-2-azabicyclo(2.2.1)heptane hydrochloride
CID 127264201
(1S,4R)-2-azabicyclo[2.2.1]heptane hydrochloride
CID 13078200
1-Methyl-2-azabicyclo[2.2.1]heptane
CID 66970177
5,5-Difluoro-2-azabicyclo(2.2.1)heptane hydrochloride
CID 84717355
(1R,4S)-2-azabicyclo(2.2.1)heptane hydrochloride
CID 122163564
2-Azabicyclo(3.2.1)octane hydrochloride
CID 139022794
(1R,3S,4S)-3-(trifluoromethyl)-2-azabicyclo(2.2.1)heptane hydrochloride
CID 145867377
4-Methyl-2-azabicyclo(2.2.1)heptane hydrochloride
CID 165891429
1-(Trifluoromethyl)-2-azabicyclo[2.2.1]heptane hydrochloride
CID 165951202
rac-(1R,4R,5R)-5-methyl-2-azabicyclo[2.2.1]heptane hydrochloride
CID 165979404

Frequently Asked Questions

What is the IUPAC name of (1R)-2-azoniabicyclo[2.2.1]heptane chloride?
The IUPAC name of (1R)-2-azoniabicyclo[2.2.1]heptane chloride (CID 171919322) is (1R)-2-azoniabicyclo[2.2.1]heptane chloride.
What is the SMILES notation for (1R)-2-azoniabicyclo[2.2.1]heptane chloride?
The canonical SMILES for (1R)-2-azoniabicyclo[2.2.1]heptane chloride is C1C[C@@H]2CC1C[NH2+]2.[Cl-].
What is the InChIKey of (1R)-2-azoniabicyclo[2.2.1]heptane chloride?
The InChIKey is YHUFGQLJZGRCCX-QFWZMSBNSA-N. The full InChI is InChI=1S/C6H11N.ClH/c1-2-6-3-5(1)4-7-6;/h5-7H,1-4H2;1H/t5?,6-;/m1./s1.
What are the key properties of (1R)-2-azoniabicyclo[2.2.1]heptane chloride?
(1R)-2-azoniabicyclo[2.2.1]heptane chloride has a molecular weight of 133.62 g/mol, XLogP of -3.26, 0 rotatable bonds, 1 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (1R)-2-azoniabicyclo[2.2.1]heptane chloride is sourced from PubChem (CID 171919322), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).