C20H20FNO2 — CID 171920586
ethyl 1-ethyl-2-(2-fluorophenyl)-4H-quinoline-3-carboxylate (PubChem CID 171920586) has the molecular formula C20H20FNO2 and a molecular weight of 325.38 g/mol. Its IUPAC name is ethyl 1-ethyl-2-(2-fluorophenyl)-4H-quinoline-3-carboxylate.
| Compound Name | ethyl 1-ethyl-2-(2-fluorophenyl)-4H-quinoline-3-carboxylate |
|---|---|
| PubChem CID | 171920586 |
| Molecular Formula | C20H20FNO2 |
| Molecular Weight | 325.38 g/mol |
| Exact Mass | 325.15 |
| IUPAC Name | ethyl 1-ethyl-2-(2-fluorophenyl)-4H-quinoline-3-carboxylate |
| SMILES | CCOC(=O)C1=C(c2ccccc2F)N(CC)c2ccccc2C1 |
| InChI | InChI=1S/C20H20FNO2/c1-3-22-18-12-8-5-9-14(18)13-16(20(23)24-4-2)19(22)15-10-6-7-11-17(15)21/h5-12H,3-4,13H2,1-2H3 |
| InChIKey | KRBQKGJMNPQGJW-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.38 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |