C13H18F12O2Si — CID 171920603
2,2,3,3,4,4,5,5,6,6,7,7-dodecafluorooctoxy-methoxy-methyl-propylsilane (PubChem CID 171920603) has the molecular formula C13H18F12O2Si and a molecular weight of 462.35 g/mol. Its IUPAC name is 2,2,3,3,4,4,5,5,6,6,7,7-dodecafluorooctoxy-methoxy-methyl-propylsilane.
| Compound Name | 2,2,3,3,4,4,5,5,6,6,7,7-dodecafluorooctoxy-methoxy-methyl-propylsilane |
|---|---|
| PubChem CID | 171920603 |
| Molecular Formula | C13H18F12O2Si |
| Molecular Weight | 462.35 g/mol |
| Exact Mass | 462.09 |
| IUPAC Name | 2,2,3,3,4,4,5,5,6,6,7,7-dodecafluorooctoxy-methoxy-methyl-propylsilane |
| SMILES | CCC[Si](C)(OC)OCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(C)(F)F |
| InChI | InChI=1S/C13H18F12O2Si/c1-5-6-28(4,26-3)27-7-9(16,17)11(20,21)13(24,25)12(22,23)10(18,19)8(2,14)15/h5-7H2,1-4H3 |
| InChIKey | RBBNRTHZKASLCP-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.35 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|