C27H20F18 — CID 171920631
2,7-bis(4,4,5,5,6,6,7,7,7-nonafluoroheptyl)-9H-fluorene (PubChem CID 171920631) has the molecular formula C27H20F18 and a molecular weight of 686.42 g/mol. Its IUPAC name is 2,7-bis(4,4,5,5,6,6,7,7,7-nonafluoroheptyl)-9H-fluorene.
| Compound Name | 2,7-bis(4,4,5,5,6,6,7,7,7-nonafluoroheptyl)-9H-fluorene |
|---|---|
| PubChem CID | 171920631 |
| Molecular Formula | C27H20F18 |
| Molecular Weight | 686.42 g/mol |
| Exact Mass | 686.13 |
| IUPAC Name | 2,7-bis(4,4,5,5,6,6,7,7,7-nonafluoroheptyl)-9H-fluorene |
| SMILES | FC(F)(F)C(F)(F)C(F)(F)C(F)(F)CCCc1ccc2c(c1)Cc1cc(CCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)F)ccc1-2 |
| InChI | InChI=1S/C27H20F18/c28-20(29,22(32,33)24(36,37)26(40,41)42)9-1-3-14-5-7-18-16(11-14)13-17-12-15(6-8-19(17)18)4-2-10-21(30,31)23(34,35)25(38,39)27(43,44)45/h5-8,11-12H,1-4,9-10,13H2 |
| InChIKey | FLRDVRLIBRFPNB-UHFFFAOYSA-N |
| XLogP | 10.84 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 686.42 |
| LogP ≤ 5 | 10.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|