C33H16F18O2 — CID 171920647
4-[9-(4-hydroxyphenyl)-2,7-bis(1,1,2,2,3,3,4,4,4-nonafluorobutyl)fluoren-9-yl]phenol (PubChem CID 171920647) has the molecular formula C33H16F18O2 and a molecular weight of 786.45 g/mol. Its IUPAC name is 4-[9-(4-hydroxyphenyl)-2,7-bis(1,1,2,2,3,3,4,4,4-nonafluorobutyl)fluoren-9-yl]phenol.
| Compound Name | 4-[9-(4-hydroxyphenyl)-2,7-bis(1,1,2,2,3,3,4,4,4-nonafluorobutyl)fluoren-9-yl]phenol |
|---|---|
| PubChem CID | 171920647 |
| Molecular Formula | C33H16F18O2 |
| Molecular Weight | 786.45 g/mol |
| Exact Mass | 786.09 |
| IUPAC Name | 4-[9-(4-hydroxyphenyl)-2,7-bis(1,1,2,2,3,3,4,4,4-nonafluorobutyl)fluoren-9-yl]phenol |
| SMILES | Oc1ccc(C2(c3ccc(O)cc3)c3cc(C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)ccc3-c3ccc(C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)cc32)cc1 |
| InChI | InChI=1S/C33H16F18O2/c34-26(35,28(38,39)30(42,43)32(46,47)48)17-5-11-21-22-12-6-18(27(36,37)29(40,41)31(44,45)33(49,50)51)14-24(22)25(23(21)13-17,15-1-7-19(52)8-2-15)16-3-9-20(53)10-4-16/h1-14,52-53H |
| InChIKey | GXXOCXLTCQWCPZ-UHFFFAOYSA-N |
| XLogP | 11.31 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 786.45 |
| LogP ≤ 5 | 11.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|