C39H28F18O2 — CID 171920648
4-[9-(4-hydroxyphenyl)-2,7-bis(4,4,5,5,6,6,7,7,7-nonafluoroheptyl)fluoren-9-yl]phenol (PubChem CID 171920648) has the molecular formula C39H28F18O2 and a molecular weight of 870.61 g/mol. Its IUPAC name is 4-[9-(4-hydroxyphenyl)-2,7-bis(4,4,5,5,6,6,7,7,7-nonafluoroheptyl)fluoren-9-yl]phenol.
| Compound Name | 4-[9-(4-hydroxyphenyl)-2,7-bis(4,4,5,5,6,6,7,7,7-nonafluoroheptyl)fluoren-9-yl]phenol |
|---|---|
| PubChem CID | 171920648 |
| Molecular Formula | C39H28F18O2 |
| Molecular Weight | 870.61 g/mol |
| Exact Mass | 870.18 |
| IUPAC Name | 4-[9-(4-hydroxyphenyl)-2,7-bis(4,4,5,5,6,6,7,7,7-nonafluoroheptyl)fluoren-9-yl]phenol |
| SMILES | Oc1ccc(C2(c3ccc(O)cc3)c3cc(CCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)F)ccc3-c3ccc(CCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)F)cc32)cc1 |
| InChI | InChI=1S/C39H28F18O2/c40-31(41,34(44,45)36(48,49)38(52,53)54)17-1-3-21-5-15-27-28-16-6-22(4-2-18-32(42,43)35(46,47)37(50,51)39(55,56)57)20-30(28)33(29(27)19-21,23-7-11-25(58)12-8-23)24-9-13-26(59)14-10-24/h5-16,19-20,58-59H,1-4,17-18H2 |
| InChIKey | LHXWFGVPBNIKTR-UHFFFAOYSA-N |
| XLogP | 13.04 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 870.61 |
| LogP ≤ 5 | 13.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|