C14H11N3O2S2 — CID 171920717
(2E,5Z)-5-[(3-methoxyphenyl)methylidene]-2-(1,3-thiazol-2-ylimino)-1,3-thiazolidin-4-one (PubChem CID 171920717) has the molecular formula C14H11N3O2S2 and a molecular weight of 317.40 g/mol. Its IUPAC name is (2E,5Z)-5-[(3-methoxyphenyl)methylidene]-2-(1,3-thiazol-2-ylimino)-1,3-thiazolidin-4-one.
| Compound Name | (2E,5Z)-5-[(3-methoxyphenyl)methylidene]-2-(1,3-thiazol-2-ylimino)-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 171920717 |
| Molecular Formula | C14H11N3O2S2 |
| Molecular Weight | 317.40 g/mol |
| Exact Mass | 317.03 |
| IUPAC Name | (2E,5Z)-5-[(3-methoxyphenyl)methylidene]-2-(1,3-thiazol-2-ylimino)-1,3-thiazolidin-4-one |
| SMILES | COc1cccc(/C=C2\S/C(=N/c3nccs3)NC2=O)c1 |
| InChI | InChI=1S/C14H11N3O2S2/c1-19-10-4-2-3-9(7-10)8-11-12(18)16-14(21-11)17-13-15-5-6-20-13/h2-8H,1H3,(H,15,16,17,18)/b11-8- |
| InChIKey | JIFHWWVFNRNCEZ-FLIBITNWSA-N |
| XLogP | 3.04 |
| TPSA | 63.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.40 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|