About 4,6-Dichloropyrimidine-5-carboxylic acid, sodium salt
4,6-Dichloropyrimidine-5-carboxylic acid, sodium salt (PubChem CID 171921195) has the molecular formula C5H4Cl2N2NaO2
and a molecular weight of 218.00 g/mol.
Molecular Properties
| Compound Name | 4,6-Dichloropyrimidine-5-carboxylic acid, sodium salt |
| PubChem CID | 171921195 |
| Molecular Formula | C5H4Cl2N2NaO2 |
| Molecular Weight | 218.00 g/mol |
| Exact Mass | 216.95 |
| IUPAC Name | — |
| SMILES | O=C(O)c1c(Cl)ncnc1Cl.[H][H].[Na] |
| InChI | InChI=1S/C5H2Cl2N2O2.Na.H2/c6-3-2(5(10)11)4(7)9-1-8-3;;/h1H,(H,10,11);;1H |
| InChIKey | KFZIQOMAUKJXPH-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 63.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.00 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4,6-Dichloropyrimidine-5-carboxylic acid, sodium salt with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,6-Dichloropyrimidine-5-carboxylic acid, sodium salt?
The IUPAC name of 4,6-Dichloropyrimidine-5-carboxylic acid, sodium salt (CID 171921195) is not available.
What is the SMILES notation for 4,6-Dichloropyrimidine-5-carboxylic acid, sodium salt?
The canonical SMILES for 4,6-Dichloropyrimidine-5-carboxylic acid, sodium salt is O=C(O)c1c(Cl)ncnc1Cl.[H][H].[Na].
What is the InChIKey of 4,6-Dichloropyrimidine-5-carboxylic acid, sodium salt?
The InChIKey is KFZIQOMAUKJXPH-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H2Cl2N2O2.Na.H2/c6-3-2(5(10)11)4(7)9-1-8-3;;/h1H,(H,10,11);;1H.
What are the key properties of 4,6-Dichloropyrimidine-5-carboxylic acid, sodium salt?
4,6-Dichloropyrimidine-5-carboxylic acid, sodium salt has a molecular weight of 218.00 g/mol, XLogP of 1.35, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4,6-Dichloropyrimidine-5-carboxylic acid, sodium salt is sourced from PubChem (CID 171921195), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).