C11H17N3 — CID 171921881
1-cyclobutyl-4,5,6,7-tetrahydroindazol-5-amine (PubChem CID 171921881) has the molecular formula C11H17N3 and a molecular weight of 191.28 g/mol. Its IUPAC name is 1-cyclobutyl-4,5,6,7-tetrahydroindazol-5-amine.
| Compound Name | 1-cyclobutyl-4,5,6,7-tetrahydroindazol-5-amine |
|---|---|
| PubChem CID | 171921881 |
| Molecular Formula | C11H17N3 |
| Molecular Weight | 191.28 g/mol |
| Exact Mass | 191.14 |
| IUPAC Name | 1-cyclobutyl-4,5,6,7-tetrahydroindazol-5-amine |
| SMILES | NC1CCc2c(cnn2C2CCC2)C1 |
| InChI | InChI=1S/C11H17N3/c12-9-4-5-11-8(6-9)7-13-14(11)10-2-1-3-10/h7,9-10H,1-6,12H2 |
| InChIKey | ABWAWGZYVRSPOP-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.28 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |