C25H21FN5O3+ — CID 171922044
4-[4-[5-(4-fluorophenyl)-3-piperidin-4-ylimidazol-4-yl]pyrimidin-2-yl]oxycyclohexa-1,3,5-triene-1-carboxylic acid (PubChem CID 171922044) has the molecular formula C25H21FN5O3+ and a molecular weight of 458.47 g/mol. Its IUPAC name is 4-[4-[5-(4-fluorophenyl)-3-piperidin-4-ylimidazol-4-yl]pyrimidin-2-yl]oxycyclohexa-1,3,5-triene-1-carboxylic acid.
| Compound Name | 4-[4-[5-(4-fluorophenyl)-3-piperidin-4-ylimidazol-4-yl]pyrimidin-2-yl]oxycyclohexa-1,3,5-triene-1-carboxylic acid |
|---|---|
| PubChem CID | 171922044 |
| Molecular Formula | C25H21FN5O3+ |
| Molecular Weight | 458.47 g/mol |
| Exact Mass | 458.16 |
| IUPAC Name | 4-[4-[5-(4-fluorophenyl)-3-piperidin-4-ylimidazol-4-yl]pyrimidin-2-yl]oxycyclohexa-1,3,5-triene-1-carboxylic acid |
| SMILES | O=C(O)C1=[C+]C=C(Oc2nccc(-c3c(-c4ccc(F)cc4)ncn3C3CCNCC3)n2)C=C1 |
| InChI | InChI=1S/C25H20FN5O3/c26-18-5-1-16(2-6-18)22-23(31(15-29-22)19-9-12-27-13-10-19)21-11-14-28-25(30-21)34-20-7-3-17(4-8-20)24(32)33/h1-3,5-8,11,14-15,19,27H,9-10,12-13H2/p+1 |
| InChIKey | ZCZPONLNZILTPC-UHFFFAOYSA-O |
| XLogP | 3.72 |
| TPSA | 102.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.47 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|