C34H43F6O3PS — CID 171922881
1,1,2,2,3,3-hexafluorobutane-1-sulfonic acid;tris(4-tert-butylphenyl)phosphane (PubChem CID 171922881) has the molecular formula C34H43F6O3PS and a molecular weight of 676.74 g/mol. Its IUPAC name is 1,1,2,2,3,3-hexafluorobutane-1-sulfonic acid;tris(4-tert-butylphenyl)phosphane.
| Compound Name | 1,1,2,2,3,3-hexafluorobutane-1-sulfonic acid;tris(4-tert-butylphenyl)phosphane |
|---|---|
| PubChem CID | 171922881 |
| Molecular Formula | C34H43F6O3PS |
| Molecular Weight | 676.74 g/mol |
| Exact Mass | 676.26 |
| IUPAC Name | 1,1,2,2,3,3-hexafluorobutane-1-sulfonic acid;tris(4-tert-butylphenyl)phosphane |
| SMILES | CC(C)(C)c1ccc(P(c2ccc(C(C)(C)C)cc2)c2ccc(C(C)(C)C)cc2)cc1.CC(F)(F)C(F)(F)C(F)(F)S(=O)(=O)O |
| InChI | InChI=1S/C30H39P.C4H4F6O3S/c1-28(2,3)22-10-16-25(17-11-22)31(26-18-12-23(13-19-26)29(4,5)6)27-20-14-24(15-21-27)30(7,8)9;1-2(5,6)3(7,8)4(9,10)14(11,12)13/h10-21H,1-9H3;1H3,(H,11,12,13) |
| InChIKey | LHSYZAOEGITVMP-UHFFFAOYSA-N |
| XLogP | 9.09 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 676.74 |
| LogP ≤ 5 | 9.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|