C16H13F7O3S2 — CID 171922889
diphenylmethanethiol;1,1,2,2,3,3,3-heptafluoropropane-1-sulfonic acid (PubChem CID 171922889) has the molecular formula C16H13F7O3S2 and a molecular weight of 450.40 g/mol. Its IUPAC name is diphenylmethanethiol;1,1,2,2,3,3,3-heptafluoropropane-1-sulfonic acid.
| Compound Name | diphenylmethanethiol;1,1,2,2,3,3,3-heptafluoropropane-1-sulfonic acid |
|---|---|
| PubChem CID | 171922889 |
| Molecular Formula | C16H13F7O3S2 |
| Molecular Weight | 450.40 g/mol |
| Exact Mass | 450.02 |
| IUPAC Name | diphenylmethanethiol;1,1,2,2,3,3,3-heptafluoropropane-1-sulfonic acid |
| SMILES | O=S(=O)(O)C(F)(F)C(F)(F)C(F)(F)F.SC(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C13H12S.C3HF7O3S/c14-13(11-7-3-1-4-8-11)12-9-5-2-6-10-12;4-1(5,2(6,7)8)3(9,10)14(11,12)13/h1-10,13-14H;(H,11,12,13) |
| InChIKey | QOQGPVLMMGSMBE-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.40 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|