C27H33F3N4O2 — CID 171923660
N-benzyl-3,3,3-trifluoropropan-1-amine;6-ethyl-1-(2,4,6-trimethylphenyl)-2,3-dihydroimidazo[1,2-a]imidazole-5-carboxylic acid (PubChem CID 171923660) has the molecular formula C27H33F3N4O2 and a molecular weight of 502.58 g/mol. Its IUPAC name is N-benzyl-3,3,3-trifluoropropan-1-amine;6-ethyl-1-(2,4,6-trimethylphenyl)-2,3-dihydroimidazo[1,2-a]imidazole-5-carboxylic acid.
| Compound Name | N-benzyl-3,3,3-trifluoropropan-1-amine;6-ethyl-1-(2,4,6-trimethylphenyl)-2,3-dihydroimidazo[1,2-a]imidazole-5-carboxylic acid |
|---|---|
| PubChem CID | 171923660 |
| Molecular Formula | C27H33F3N4O2 |
| Molecular Weight | 502.58 g/mol |
| Exact Mass | 502.26 |
| IUPAC Name | N-benzyl-3,3,3-trifluoropropan-1-amine;6-ethyl-1-(2,4,6-trimethylphenyl)-2,3-dihydroimidazo[1,2-a]imidazole-5-carboxylic acid |
| SMILES | CCc1nc2n(c1C(=O)O)CCN2c1c(C)cc(C)cc1C.FC(F)(F)CCNCc1ccccc1 |
| InChI | InChI=1S/C17H21N3O2.C10H12F3N/c1-5-13-15(16(21)22)20-7-6-19(17(20)18-13)14-11(3)8-10(2)9-12(14)4;11-10(12,13)6-7-14-8-9-4-2-1-3-5-9/h8-9H,5-7H2,1-4H3,(H,21,22);1-5,14H,6-8H2 |
| InChIKey | WCKHURCODYGFNB-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 70.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.58 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|