C29H30F3N5O5 — CID 171924121
2-(2-hydroxyethylamino)-1-[3-[(4-methoxyphenyl)methyl]-8,9-dihydro-6H-pyrazolo[4,3-f][2,7]naphthyridin-7-yl]-2-phenylethanone;2,2,2-trifluoroacetic acid (PubChem CID 171924121) has the molecular formula C29H30F3N5O5 and a molecular weight of 585.58 g/mol. Its IUPAC name is 2-(2-hydroxyethylamino)-1-[3-[(4-methoxyphenyl)methyl]-8,9-dihydro-6H-pyrazolo[4,3-f][2,7]naphthyridin-7-yl]-2-phenylethanone;2,2,2-trifluoroacetic acid.
| Compound Name | 2-(2-hydroxyethylamino)-1-[3-[(4-methoxyphenyl)methyl]-8,9-dihydro-6H-pyrazolo[4,3-f][2,7]naphthyridin-7-yl]-2-phenylethanone;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 171924121 |
| Molecular Formula | C29H30F3N5O5 |
| Molecular Weight | 585.58 g/mol |
| Exact Mass | 585.22 |
| IUPAC Name | 2-(2-hydroxyethylamino)-1-[3-[(4-methoxyphenyl)methyl]-8,9-dihydro-6H-pyrazolo[4,3-f][2,7]naphthyridin-7-yl]-2-phenylethanone;2,2,2-trifluoroacetic acid |
| SMILES | COc1ccc(Cn2ncc3c4c(cnc32)CN(C(=O)C(NCCO)c2ccccc2)CC4)cc1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C27H29N5O3.C2HF3O2/c1-35-22-9-7-19(8-10-22)17-32-26-24(16-30-32)23-11-13-31(18-21(23)15-29-26)27(34)25(28-12-14-33)20-5-3-2-4-6-20;3-2(4,5)1(6)7/h2-10,15-16,25,28,33H,11-14,17-18H2,1H3;(H,6,7) |
| InChIKey | AXQRIFKRKUYFHY-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 129.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.58 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |