C4H17F3NO3SSi+3 — CID 171924337
N,N-dimethylmethanamine;silicon(4+);trifluoromethanesulfonate (PubChem CID 171924337) has the molecular formula C4H17F3NO3SSi+3 and a molecular weight of 244.33 g/mol. Its IUPAC name is N,N-dimethylmethanamine;silicon(4+);trifluoromethanesulfonate.
| Compound Name | N,N-dimethylmethanamine;silicon(4+);trifluoromethanesulfonate |
|---|---|
| PubChem CID | 171924337 |
| Molecular Formula | C4H17F3NO3SSi+3 |
| Molecular Weight | 244.33 g/mol |
| Exact Mass | 244.06 |
| IUPAC Name | N,N-dimethylmethanamine;silicon(4+);trifluoromethanesulfonate |
| SMILES | CN(C)C.O=S(=O)([O-])C(F)(F)F.[SiH8+4] |
| InChI | InChI=1S/C3H9N.CHF3O3S.H8Si/c1-4(2)3;2-1(3,4)8(5,6)7;/h1-3H3;(H,5,6,7);1H8/q;;+4/p-1 |
| InChIKey | QJMASTJUXGIRBM-UHFFFAOYSA-M |
| XLogP | -2.29 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.33 |
| LogP ≤ 5 | -2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|