About N,N-dimethylmethanamine;silicon(4+);trifluoromethanesulfonate
N,N-dimethylmethanamine;silicon(4+);trifluoromethanesulfonate (PubChem CID 171924337) has the molecular formula C4H17F3NO3SSi+3
and a molecular weight of 244.33 g/mol. Its IUPAC name is N,N-dimethylmethanamine;silicon(4+);trifluoromethanesulfonate.
Molecular Properties
| Compound Name | N,N-dimethylmethanamine;silicon(4+);trifluoromethanesulfonate |
| PubChem CID | 171924337 |
| Molecular Formula | C4H17F3NO3SSi+3 |
| Molecular Weight | 244.33 g/mol |
| Exact Mass | 244.06 |
| IUPAC Name | N,N-dimethylmethanamine;silicon(4+);trifluoromethanesulfonate |
| SMILES | CN(C)C.O=S(=O)([O-])C(F)(F)F.[SiH8+4] |
| InChI | InChI=1S/C3H9N.CHF3O3S.H8Si/c1-4(2)3;2-1(3,4)8(5,6)7;/h1-3H3;(H,5,6,7);1H8/q;;+4/p-1 |
| InChIKey | QJMASTJUXGIRBM-UHFFFAOYSA-M |
| XLogP | -2.29 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.33 |
| LogP ≤ 5 | -2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|
Analyze N,N-dimethylmethanamine;silicon(4+);trifluoromethanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-dimethylmethanamine;silicon(4+);trifluoromethanesulfonate?
The IUPAC name of N,N-dimethylmethanamine;silicon(4+);trifluoromethanesulfonate (CID 171924337) is N,N-dimethylmethanamine;silicon(4+);trifluoromethanesulfonate.
What is the SMILES notation for N,N-dimethylmethanamine;silicon(4+);trifluoromethanesulfonate?
The canonical SMILES for N,N-dimethylmethanamine;silicon(4+);trifluoromethanesulfonate is CN(C)C.O=S(=O)([O-])C(F)(F)F.[SiH8+4].
What is the InChIKey of N,N-dimethylmethanamine;silicon(4+);trifluoromethanesulfonate?
The InChIKey is QJMASTJUXGIRBM-UHFFFAOYSA-M. The full InChI is InChI=1S/C3H9N.CHF3O3S.H8Si/c1-4(2)3;2-1(3,4)8(5,6)7;/h1-3H3;(H,5,6,7);1H8/q;;+4/p-1.
What are the key properties of N,N-dimethylmethanamine;silicon(4+);trifluoromethanesulfonate?
N,N-dimethylmethanamine;silicon(4+);trifluoromethanesulfonate has a molecular weight of 244.33 g/mol, XLogP of -2.29, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-dimethylmethanamine;silicon(4+);trifluoromethanesulfonate is sourced from PubChem (CID 171924337), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).