C23H20Cl3F3N2S — CID 171924404
1-methyl-3-[2-[5-[(E)-4,4,4-trifluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]-2,3-dihydro-1H-inden-1-yl]ethylidene]thiourea (PubChem CID 171924404) has the molecular formula C23H20Cl3F3N2S and a molecular weight of 519.85 g/mol. Its IUPAC name is 1-methyl-3-[2-[5-[(E)-4,4,4-trifluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]-2,3-dihydro-1H-inden-1-yl]ethylidene]thiourea.
| Compound Name | 1-methyl-3-[2-[5-[(E)-4,4,4-trifluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]-2,3-dihydro-1H-inden-1-yl]ethylidene]thiourea |
|---|---|
| PubChem CID | 171924404 |
| Molecular Formula | C23H20Cl3F3N2S |
| Molecular Weight | 519.85 g/mol |
| Exact Mass | 518.04 |
| IUPAC Name | 1-methyl-3-[2-[5-[(E)-4,4,4-trifluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]-2,3-dihydro-1H-inden-1-yl]ethylidene]thiourea |
| SMILES | CNC(=S)N=CCC1CCc2cc(/C=C/C(c3cc(Cl)c(Cl)c(Cl)c3)C(F)(F)F)ccc21 |
| InChI | InChI=1S/C23H20Cl3F3N2S/c1-30-22(32)31-9-8-14-4-5-15-10-13(2-6-17(14)15)3-7-18(23(27,28)29)16-11-19(24)21(26)20(25)12-16/h2-3,6-7,9-12,14,18H,4-5,8H2,1H3,(H,30,32)/b7-3+,31-9? |
| InChIKey | SMJAEGLBFXGLGC-XGXAHHHSSA-N |
| XLogP | 8.00 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.85 |
| LogP ≤ 5 | 8.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|