C15H24F3N3 — CID 171924551
2-methylpyrrolidine;(1R)-1-[6-(trifluoromethyl)-3-pyridinyl]butan-1-amine (PubChem CID 171924551) has the molecular formula C15H24F3N3 and a molecular weight of 303.37 g/mol. Its IUPAC name is 2-methylpyrrolidine;(1R)-1-[6-(trifluoromethyl)-3-pyridinyl]butan-1-amine.
| Compound Name | 2-methylpyrrolidine;(1R)-1-[6-(trifluoromethyl)-3-pyridinyl]butan-1-amine |
|---|---|
| PubChem CID | 171924551 |
| Molecular Formula | C15H24F3N3 |
| Molecular Weight | 303.37 g/mol |
| Exact Mass | 303.19 |
| IUPAC Name | 2-methylpyrrolidine;(1R)-1-[6-(trifluoromethyl)-3-pyridinyl]butan-1-amine |
| SMILES | CC1CCCN1.CCC[C@@H](N)c1ccc(C(F)(F)F)nc1 |
| InChI | InChI=1S/C10H13F3N2.C5H11N/c1-2-3-8(14)7-4-5-9(15-6-7)10(11,12)13;1-5-3-2-4-6-5/h4-6,8H,2-3,14H2,1H3;5-6H,2-4H2,1H3/t8-;/m1./s1 |
| InChIKey | DIGSFSREBUYPBK-DDWIOCJRSA-N |
| XLogP | 3.66 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.37 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |