C15H17F3N4O3 — CID 171925444
2-piperidin-3-ylindazole-7-carboxamide;2,2,2-trifluoroacetic acid (PubChem CID 171925444) has the molecular formula C15H17F3N4O3 and a molecular weight of 358.32 g/mol. Its IUPAC name is 2-piperidin-3-ylindazole-7-carboxamide;2,2,2-trifluoroacetic acid.
| Compound Name | 2-piperidin-3-ylindazole-7-carboxamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 171925444 |
| Molecular Formula | C15H17F3N4O3 |
| Molecular Weight | 358.32 g/mol |
| Exact Mass | 358.13 |
| IUPAC Name | 2-piperidin-3-ylindazole-7-carboxamide;2,2,2-trifluoroacetic acid |
| SMILES | NC(=O)c1cccc2cn(C3CCCNC3)nc12.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C13H16N4O.C2HF3O2/c14-13(18)11-5-1-3-9-8-17(16-12(9)11)10-4-2-6-15-7-10;3-2(4,5)1(6)7/h1,3,5,8,10,15H,2,4,6-7H2,(H2,14,18);(H,6,7) |
| InChIKey | JQKMNDQEIYQUJU-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 110.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.32 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |