C8H17F6N3O4S2 — CID 171925526
3,3-dimethylbutane-1,1-diamine;1,1,1-trifluoro-N-(trifluoromethylsulfonyl)methanesulfonamide (PubChem CID 171925526) has the molecular formula C8H17F6N3O4S2 and a molecular weight of 397.36 g/mol. Its IUPAC name is 3,3-dimethylbutane-1,1-diamine;1,1,1-trifluoro-N-(trifluoromethylsulfonyl)methanesulfonamide.
| Compound Name | 3,3-dimethylbutane-1,1-diamine;1,1,1-trifluoro-N-(trifluoromethylsulfonyl)methanesulfonamide |
|---|---|
| PubChem CID | 171925526 |
| Molecular Formula | C8H17F6N3O4S2 |
| Molecular Weight | 397.36 g/mol |
| Exact Mass | 397.06 |
| IUPAC Name | 3,3-dimethylbutane-1,1-diamine;1,1,1-trifluoro-N-(trifluoromethylsulfonyl)methanesulfonamide |
| SMILES | CC(C)(C)CC(N)N.O=S(=O)(NS(=O)(=O)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C6H16N2.C2HF6NO4S2/c1-6(2,3)4-5(7)8;3-1(4,5)14(10,11)9-15(12,13)2(6,7)8/h5H,4,7-8H2,1-3H3;9H |
| InChIKey | NOQYEZXJWCPOGU-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 132.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.36 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|