About 2-cyclohexa-2,4-dien-1-ylidene-5,5-difluoro-5aH-benzo[g][1]benzofuran-4-one
2-cyclohexa-2,4-dien-1-ylidene-5,5-difluoro-5aH-benzo[g][1]benzofuran-4-one (PubChem CID 171925770) has the molecular formula C18H12F2O2
and a molecular weight of 298.29 g/mol. Its IUPAC name is 2-cyclohexa-2,4-dien-1-ylidene-5,5-difluoro-5aH-benzo[g][1]benzofuran-4-one.
Molecular Properties
| Compound Name | 2-cyclohexa-2,4-dien-1-ylidene-5,5-difluoro-5aH-benzo[g][1]benzofuran-4-one |
| PubChem CID | 171925770 |
| Molecular Formula | C18H12F2O2 |
| Molecular Weight | 298.29 g/mol |
| Exact Mass | 298.08 |
| IUPAC Name | 2-cyclohexa-2,4-dien-1-ylidene-5,5-difluoro-5aH-benzo[g][1]benzofuran-4-one |
| SMILES | O=C1c2cc(=C3C=CC=CC3)oc2=C2C=CC=CC2C1(F)F |
| InChI | InChI=1S/C18H12F2O2/c19-18(20)14-9-5-4-8-12(14)16-13(17(18)21)10-15(22-16)11-6-2-1-3-7-11/h1-6,8-10,14H,7H2 |
| InChIKey | JLINAAVYJYKLKG-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 30.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.29 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-cyclohexa-2,4-dien-1-ylidene-5,5-difluoro-5aH-benzo[g][1]benzofuran-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyclohexa-2,4-dien-1-ylidene-5,5-difluoro-5aH-benzo[g][1]benzofuran-4-one?
The IUPAC name of 2-cyclohexa-2,4-dien-1-ylidene-5,5-difluoro-5aH-benzo[g][1]benzofuran-4-one (CID 171925770) is 2-cyclohexa-2,4-dien-1-ylidene-5,5-difluoro-5aH-benzo[g][1]benzofuran-4-one.
What is the SMILES notation for 2-cyclohexa-2,4-dien-1-ylidene-5,5-difluoro-5aH-benzo[g][1]benzofuran-4-one?
The canonical SMILES for 2-cyclohexa-2,4-dien-1-ylidene-5,5-difluoro-5aH-benzo[g][1]benzofuran-4-one is O=C1c2cc(=C3C=CC=CC3)oc2=C2C=CC=CC2C1(F)F.
What is the InChIKey of 2-cyclohexa-2,4-dien-1-ylidene-5,5-difluoro-5aH-benzo[g][1]benzofuran-4-one?
The InChIKey is JLINAAVYJYKLKG-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H12F2O2/c19-18(20)14-9-5-4-8-12(14)16-13(17(18)21)10-15(22-16)11-6-2-1-3-7-11/h1-6,8-10,14H,7H2.
What are the key properties of 2-cyclohexa-2,4-dien-1-ylidene-5,5-difluoro-5aH-benzo[g][1]benzofuran-4-one?
2-cyclohexa-2,4-dien-1-ylidene-5,5-difluoro-5aH-benzo[g][1]benzofuran-4-one has a molecular weight of 298.29 g/mol, XLogP of 2.67, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyclohexa-2,4-dien-1-ylidene-5,5-difluoro-5aH-benzo[g][1]benzofuran-4-one is sourced from PubChem (CID 171925770), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).