C16H22F3N5O5 — CID 171927147
methyl (2R,3R)-4-azido-2-(dipropylcarbamoyl)-3-[(2,2,2-trifluoroacetyl)amino]-3,4-dihydro-2H-pyran-6-carboxylate (PubChem CID 171927147) has the molecular formula C16H22F3N5O5 and a molecular weight of 421.38 g/mol. Its IUPAC name is methyl (2R,3R)-4-azido-2-(dipropylcarbamoyl)-3-[(2,2,2-trifluoroacetyl)amino]-3,4-dihydro-2H-pyran-6-carboxylate.
| Compound Name | methyl (2R,3R)-4-azido-2-(dipropylcarbamoyl)-3-[(2,2,2-trifluoroacetyl)amino]-3,4-dihydro-2H-pyran-6-carboxylate |
|---|---|
| PubChem CID | 171927147 |
| Molecular Formula | C16H22F3N5O5 |
| Molecular Weight | 421.38 g/mol |
| Exact Mass | 421.16 |
| IUPAC Name | methyl (2R,3R)-4-azido-2-(dipropylcarbamoyl)-3-[(2,2,2-trifluoroacetyl)amino]-3,4-dihydro-2H-pyran-6-carboxylate |
| SMILES | CCCN(CCC)C(=O)[C@@H]1OC(C(=O)OC)=CC(N=[N+]=[N-])[C@H]1NC(=O)C(F)(F)F |
| InChI | InChI=1S/C16H22F3N5O5/c1-4-6-24(7-5-2)13(25)12-11(21-15(27)16(17,18)19)9(22-23-20)8-10(29-12)14(26)28-3/h8-9,11-12H,4-7H2,1-3H3,(H,21,27)/t9?,11-,12-/m1/s1 |
| InChIKey | HKGVLKNBZIIWPA-JZXPMDSESA-N |
| XLogP | 1.82 |
| TPSA | 133.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.38 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|