C15H12F6N2O4S2 — CID 171927868
N-[1-(2-methyl-1,3-thiazol-4-yl)ethyl]-5-(2,2,2-trifluoroacetyl)thiophene-2-carboxamide;2,2,2-trifluoroacetic acid (PubChem CID 171927868) has the molecular formula C15H12F6N2O4S2 and a molecular weight of 462.39 g/mol. Its IUPAC name is N-[1-(2-methyl-1,3-thiazol-4-yl)ethyl]-5-(2,2,2-trifluoroacetyl)thiophene-2-carboxamide;2,2,2-trifluoroacetic acid.
| Compound Name | N-[1-(2-methyl-1,3-thiazol-4-yl)ethyl]-5-(2,2,2-trifluoroacetyl)thiophene-2-carboxamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 171927868 |
| Molecular Formula | C15H12F6N2O4S2 |
| Molecular Weight | 462.39 g/mol |
| Exact Mass | 462.01 |
| IUPAC Name | N-[1-(2-methyl-1,3-thiazol-4-yl)ethyl]-5-(2,2,2-trifluoroacetyl)thiophene-2-carboxamide;2,2,2-trifluoroacetic acid |
| SMILES | Cc1nc(C(C)NC(=O)c2ccc(C(=O)C(F)(F)F)s2)cs1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C13H11F3N2O2S2.C2HF3O2/c1-6(8-5-21-7(2)18-8)17-12(20)10-4-3-9(22-10)11(19)13(14,15)16;3-2(4,5)1(6)7/h3-6H,1-2H3,(H,17,20);(H,6,7) |
| InChIKey | BWVWCGXZPMRKMQ-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 96.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.39 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |