C33H35F3O5S2 — CID 171928092
1,2-bis[4-[(2-methylpropan-2-yl)oxy]phenyl]-3-phenylsulfanylbenzene;trifluoromethanesulfonic acid (PubChem CID 171928092) has the molecular formula C33H35F3O5S2 and a molecular weight of 632.77 g/mol. Its IUPAC name is 1,2-bis[4-[(2-methylpropan-2-yl)oxy]phenyl]-3-phenylsulfanylbenzene;trifluoromethanesulfonic acid.
| Compound Name | 1,2-bis[4-[(2-methylpropan-2-yl)oxy]phenyl]-3-phenylsulfanylbenzene;trifluoromethanesulfonic acid |
|---|---|
| PubChem CID | 171928092 |
| Molecular Formula | C33H35F3O5S2 |
| Molecular Weight | 632.77 g/mol |
| Exact Mass | 632.19 |
| IUPAC Name | 1,2-bis[4-[(2-methylpropan-2-yl)oxy]phenyl]-3-phenylsulfanylbenzene;trifluoromethanesulfonic acid |
| SMILES | CC(C)(C)Oc1ccc(-c2cccc(Sc3ccccc3)c2-c2ccc(OC(C)(C)C)cc2)cc1.O=S(=O)(O)C(F)(F)F |
| InChI | InChI=1S/C32H34O2S.CHF3O3S/c1-31(2,3)33-25-19-15-23(16-20-25)28-13-10-14-29(35-27-11-8-7-9-12-27)30(28)24-17-21-26(22-18-24)34-32(4,5)6;2-1(3,4)8(5,6)7/h7-22H,1-6H3;(H,5,6,7) |
| InChIKey | CQXLWPCOSXWEGJ-UHFFFAOYSA-N |
| XLogP | 9.92 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.77 |
| LogP ≤ 5 | 9.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|