1,4-diazabicyclo[2.2.2]octane;trifluoromethanesulfonic acid

C7H13F3N2O3S — CID 171928370

IUPAC1,4-diazabicyclo[2.2.2]octane;trifluoromethanesulfonic acid
SMILESC1CN2CCN1CC2.O=S(=O)(O)C(F)(F)F
InChIInChI=1S/C6H12N2.CHF3O3S/c1-2-8-5-3-7(1)4-6-8;2-1(3,4)8(5,6)7/h1-6H2;(H,5,6,7)
InChIKeyWFQQIVYKORWYCU-UHFFFAOYSA-N
MW262.25 g/mol
LogP0.01
Rot. Bonds

About 1,4-diazabicyclo[2.2.2]octane;trifluoromethanesulfonic acid

1,4-diazabicyclo[2.2.2]octane;trifluoromethanesulfonic acid (PubChem CID 171928370) has the molecular formula C7H13F3N2O3S and a molecular weight of 262.25 g/mol. Its IUPAC name is 1,4-diazabicyclo[2.2.2]octane;trifluoromethanesulfonic acid.

Molecular Properties

Compound Name1,4-diazabicyclo[2.2.2]octane;trifluoromethanesulfonic acid
PubChem CID171928370
Molecular FormulaC7H13F3N2O3S
Molecular Weight262.25 g/mol
Exact Mass262.06
IUPAC Name1,4-diazabicyclo[2.2.2]octane;trifluoromethanesulfonic acid
SMILESC1CN2CCN1CC2.O=S(=O)(O)C(F)(F)F
InChIInChI=1S/C6H12N2.CHF3O3S/c1-2-8-5-3-7(1)4-6-8;2-1(3,4)8(5,6)7/h1-6H2;(H,5,6,7)
InChIKeyWFQQIVYKORWYCU-UHFFFAOYSA-N
XLogP0.01
TPSA60.85 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500262.25
LogP ≤ 50.01
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'}

Analyze 1,4-diazabicyclo[2.2.2]octane;trifluoromethanesulfonic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 1,4-diazabicyclo[2.2.2]octane;trifluoromethanesulfonic acid?
The IUPAC name of 1,4-diazabicyclo[2.2.2]octane;trifluoromethanesulfonic acid (CID 171928370) is 1,4-diazabicyclo[2.2.2]octane;trifluoromethanesulfonic acid.
What is the SMILES notation for 1,4-diazabicyclo[2.2.2]octane;trifluoromethanesulfonic acid?
The canonical SMILES for 1,4-diazabicyclo[2.2.2]octane;trifluoromethanesulfonic acid is C1CN2CCN1CC2.O=S(=O)(O)C(F)(F)F.
What is the InChIKey of 1,4-diazabicyclo[2.2.2]octane;trifluoromethanesulfonic acid?
The InChIKey is WFQQIVYKORWYCU-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12N2.CHF3O3S/c1-2-8-5-3-7(1)4-6-8;2-1(3,4)8(5,6)7/h1-6H2;(H,5,6,7).
What are the key properties of 1,4-diazabicyclo[2.2.2]octane;trifluoromethanesulfonic acid?
1,4-diazabicyclo[2.2.2]octane;trifluoromethanesulfonic acid has a molecular weight of 262.25 g/mol, XLogP of 0.01, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1,4-diazabicyclo[2.2.2]octane;trifluoromethanesulfonic acid is sourced from PubChem (CID 171928370), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).