C24H29F3N4O5S2 — CID 171928567
2,4-dimethyl-N-[(1S)-7-oxo-1-(5-phenyl-1H-imidazol-2-yl)octyl]-1,3-thiazole-5-sulfonamide;2,2,2-trifluoroacetic acid (PubChem CID 171928567) has the molecular formula C24H29F3N4O5S2 and a molecular weight of 574.65 g/mol. Its IUPAC name is 2,4-dimethyl-N-[(1S)-7-oxo-1-(5-phenyl-1H-imidazol-2-yl)octyl]-1,3-thiazole-5-sulfonamide;2,2,2-trifluoroacetic acid.
| Compound Name | 2,4-dimethyl-N-[(1S)-7-oxo-1-(5-phenyl-1H-imidazol-2-yl)octyl]-1,3-thiazole-5-sulfonamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 171928567 |
| Molecular Formula | C24H29F3N4O5S2 |
| Molecular Weight | 574.65 g/mol |
| Exact Mass | 574.15 |
| IUPAC Name | 2,4-dimethyl-N-[(1S)-7-oxo-1-(5-phenyl-1H-imidazol-2-yl)octyl]-1,3-thiazole-5-sulfonamide;2,2,2-trifluoroacetic acid |
| SMILES | CC(=O)CCCCC[C@H](NS(=O)(=O)c1sc(C)nc1C)c1ncc(-c2ccccc2)[nH]1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C22H28N4O3S2.C2HF3O2/c1-15(27)10-6-4-9-13-19(26-31(28,29)22-16(2)24-17(3)30-22)21-23-14-20(25-21)18-11-7-5-8-12-18;3-2(4,5)1(6)7/h5,7-8,11-12,14,19,26H,4,6,9-10,13H2,1-3H3,(H,23,25);(H,6,7)/t19-;/m0./s1 |
| InChIKey | XAGQRENFIVZEGO-FYZYNONXSA-N |
| XLogP | 5.34 |
| TPSA | 142.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.65 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|