C27H29F3N4O5S3 — CID 171928661
5-(2-methyl-1,3-thiazol-4-yl)-N-[(1S)-7-oxo-1-(5-phenyl-1H-imidazol-2-yl)octyl]thiophene-2-sulfonamide;2,2,2-trifluoroacetic acid (PubChem CID 171928661) has the molecular formula C27H29F3N4O5S3 and a molecular weight of 642.75 g/mol. Its IUPAC name is 5-(2-methyl-1,3-thiazol-4-yl)-N-[(1S)-7-oxo-1-(5-phenyl-1H-imidazol-2-yl)octyl]thiophene-2-sulfonamide;2,2,2-trifluoroacetic acid.
| Compound Name | 5-(2-methyl-1,3-thiazol-4-yl)-N-[(1S)-7-oxo-1-(5-phenyl-1H-imidazol-2-yl)octyl]thiophene-2-sulfonamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 171928661 |
| Molecular Formula | C27H29F3N4O5S3 |
| Molecular Weight | 642.75 g/mol |
| Exact Mass | 642.13 |
| IUPAC Name | 5-(2-methyl-1,3-thiazol-4-yl)-N-[(1S)-7-oxo-1-(5-phenyl-1H-imidazol-2-yl)octyl]thiophene-2-sulfonamide;2,2,2-trifluoroacetic acid |
| SMILES | CC(=O)CCCCC[C@H](NS(=O)(=O)c1ccc(-c2csc(C)n2)s1)c1ncc(-c2ccccc2)[nH]1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C25H28N4O3S3.C2HF3O2/c1-17(30)9-5-3-8-12-20(25-26-15-21(28-25)19-10-6-4-7-11-19)29-35(31,32)24-14-13-23(34-24)22-16-33-18(2)27-22;3-2(4,5)1(6)7/h4,6-7,10-11,13-16,20,29H,3,5,8-9,12H2,1-2H3,(H,26,28);(H,6,7)/t20-;/m0./s1 |
| InChIKey | YJPJYNKGRQUOHE-BDQAORGHSA-N |
| XLogP | 6.76 |
| TPSA | 142.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.75 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|