About pyridine;9,9,9-trifluorononane-1-sulfonic acid
pyridine;9,9,9-trifluorononane-1-sulfonic acid (PubChem CID 171929138) has the molecular formula C14H22F3NO3S
and a molecular weight of 341.39 g/mol. Its IUPAC name is pyridine;9,9,9-trifluorononane-1-sulfonic acid.
Molecular Properties
| Compound Name | pyridine;9,9,9-trifluorononane-1-sulfonic acid |
| PubChem CID | 171929138 |
| Molecular Formula | C14H22F3NO3S |
| Molecular Weight | 341.39 g/mol |
| Exact Mass | 341.13 |
| IUPAC Name | pyridine;9,9,9-trifluorononane-1-sulfonic acid |
| SMILES | O=S(=O)(O)CCCCCCCCC(F)(F)F.c1ccncc1 |
| InChI | InChI=1S/C9H17F3O3S.C5H5N/c10-9(11,12)7-5-3-1-2-4-6-8-16(13,14)15;1-2-4-6-5-3-1/h1-8H2,(H,13,14,15);1-5H |
| InChIKey | JTEIIIOZFROZFF-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 67.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 341.39 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze pyridine;9,9,9-trifluorononane-1-sulfonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pyridine;9,9,9-trifluorononane-1-sulfonic acid?
The IUPAC name of pyridine;9,9,9-trifluorononane-1-sulfonic acid (CID 171929138) is pyridine;9,9,9-trifluorononane-1-sulfonic acid.
What is the SMILES notation for pyridine;9,9,9-trifluorononane-1-sulfonic acid?
The canonical SMILES for pyridine;9,9,9-trifluorononane-1-sulfonic acid is O=S(=O)(O)CCCCCCCCC(F)(F)F.c1ccncc1.
What is the InChIKey of pyridine;9,9,9-trifluorononane-1-sulfonic acid?
The InChIKey is JTEIIIOZFROZFF-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17F3O3S.C5H5N/c10-9(11,12)7-5-3-1-2-4-6-8-16(13,14)15;1-2-4-6-5-3-1/h1-8H2,(H,13,14,15);1-5H.
What are the key properties of pyridine;9,9,9-trifluorononane-1-sulfonic acid?
pyridine;9,9,9-trifluorononane-1-sulfonic acid has a molecular weight of 341.39 g/mol, XLogP of 4.25, 8 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for pyridine;9,9,9-trifluorononane-1-sulfonic acid is sourced from PubChem (CID 171929138), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).