About 2-(4-chlorophenyl)aniline;1-methyl-3-(trifluoromethyl)pyrazole-4-carboxylic acid
2-(4-chlorophenyl)aniline;1-methyl-3-(trifluoromethyl)pyrazole-4-carboxylic acid (PubChem CID 171929428) has the molecular formula C18H15ClF3N3O2
and a molecular weight of 397.78 g/mol. Its IUPAC name is 2-(4-chlorophenyl)aniline;1-methyl-3-(trifluoromethyl)pyrazole-4-carboxylic acid.
Molecular Properties
| Compound Name | 2-(4-chlorophenyl)aniline;1-methyl-3-(trifluoromethyl)pyrazole-4-carboxylic acid |
| PubChem CID | 171929428 |
| Molecular Formula | C18H15ClF3N3O2 |
| Molecular Weight | 397.78 g/mol |
| Exact Mass | 397.08 |
| IUPAC Name | 2-(4-chlorophenyl)aniline;1-methyl-3-(trifluoromethyl)pyrazole-4-carboxylic acid |
| SMILES | Cn1cc(C(=O)O)c(C(F)(F)F)n1.Nc1ccccc1-c1ccc(Cl)cc1 |
| InChI | InChI=1S/C12H10ClN.C6H5F3N2O2/c13-10-7-5-9(6-8-10)11-3-1-2-4-12(11)14;1-11-2-3(5(12)13)4(10-11)6(7,8)9/h1-8H,14H2;2H,1H3,(H,12,13) |
| InChIKey | KJKWBAFMFCVOGC-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 81.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 397.78 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2-(4-chlorophenyl)aniline;1-methyl-3-(trifluoromethyl)pyrazole-4-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-chlorophenyl)aniline;1-methyl-3-(trifluoromethyl)pyrazole-4-carboxylic acid?
The IUPAC name of 2-(4-chlorophenyl)aniline;1-methyl-3-(trifluoromethyl)pyrazole-4-carboxylic acid (CID 171929428) is 2-(4-chlorophenyl)aniline;1-methyl-3-(trifluoromethyl)pyrazole-4-carboxylic acid.
What is the SMILES notation for 2-(4-chlorophenyl)aniline;1-methyl-3-(trifluoromethyl)pyrazole-4-carboxylic acid?
The canonical SMILES for 2-(4-chlorophenyl)aniline;1-methyl-3-(trifluoromethyl)pyrazole-4-carboxylic acid is Cn1cc(C(=O)O)c(C(F)(F)F)n1.Nc1ccccc1-c1ccc(Cl)cc1.
What is the InChIKey of 2-(4-chlorophenyl)aniline;1-methyl-3-(trifluoromethyl)pyrazole-4-carboxylic acid?
The InChIKey is KJKWBAFMFCVOGC-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10ClN.C6H5F3N2O2/c13-10-7-5-9(6-8-10)11-3-1-2-4-12(11)14;1-11-2-3(5(12)13)4(10-11)6(7,8)9/h1-8H,14H2;2H,1H3,(H,12,13).
What are the key properties of 2-(4-chlorophenyl)aniline;1-methyl-3-(trifluoromethyl)pyrazole-4-carboxylic acid?
2-(4-chlorophenyl)aniline;1-methyl-3-(trifluoromethyl)pyrazole-4-carboxylic acid has a molecular weight of 397.78 g/mol, XLogP of 4.73, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-chlorophenyl)aniline;1-methyl-3-(trifluoromethyl)pyrazole-4-carboxylic acid is sourced from PubChem (CID 171929428), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).