C33H30F3N3O4 — CID 171929561
[2-[3-[2-[4-(aminomethyl)phenyl]-3-phenyl-1,6-naphthyridin-5-yl]propoxy]phenyl]methanol;2,2,2-trifluoroacetic acid (PubChem CID 171929561) has the molecular formula C33H30F3N3O4 and a molecular weight of 589.61 g/mol. Its IUPAC name is [2-[3-[2-[4-(aminomethyl)phenyl]-3-phenyl-1,6-naphthyridin-5-yl]propoxy]phenyl]methanol;2,2,2-trifluoroacetic acid.
| Compound Name | [2-[3-[2-[4-(aminomethyl)phenyl]-3-phenyl-1,6-naphthyridin-5-yl]propoxy]phenyl]methanol;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 171929561 |
| Molecular Formula | C33H30F3N3O4 |
| Molecular Weight | 589.61 g/mol |
| Exact Mass | 589.22 |
| IUPAC Name | [2-[3-[2-[4-(aminomethyl)phenyl]-3-phenyl-1,6-naphthyridin-5-yl]propoxy]phenyl]methanol;2,2,2-trifluoroacetic acid |
| SMILES | NCc1ccc(-c2nc3ccnc(CCCOc4ccccc4CO)c3cc2-c2ccccc2)cc1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C31H29N3O2.C2HF3O2/c32-20-22-12-14-24(15-13-22)31-26(23-7-2-1-3-8-23)19-27-28(33-17-16-29(27)34-31)10-6-18-36-30-11-5-4-9-25(30)21-35;3-2(4,5)1(6)7/h1-5,7-9,11-17,19,35H,6,10,18,20-21,32H2;(H,6,7) |
| InChIKey | MOJXGDWJJGWHNV-UHFFFAOYSA-N |
| XLogP | 6.56 |
| TPSA | 118.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.61 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|