About 1H-pyrazole;1,1,1-trifluoro-N-(trifluoromethylsulfonyl)methanesulfonamide
1H-pyrazole;1,1,1-trifluoro-N-(trifluoromethylsulfonyl)methanesulfonamide (PubChem CID 171930364) has the molecular formula C5H5F6N3O4S2
and a molecular weight of 349.23 g/mol. Its IUPAC name is 1H-pyrazole;1,1,1-trifluoro-N-(trifluoromethylsulfonyl)methanesulfonamide.
Molecular Properties
| Compound Name | 1H-pyrazole;1,1,1-trifluoro-N-(trifluoromethylsulfonyl)methanesulfonamide |
| PubChem CID | 171930364 |
| Molecular Formula | C5H5F6N3O4S2 |
| Molecular Weight | 349.23 g/mol |
| Exact Mass | 348.96 |
| IUPAC Name | 1H-pyrazole;1,1,1-trifluoro-N-(trifluoromethylsulfonyl)methanesulfonamide |
| SMILES | O=S(=O)(NS(=O)(=O)C(F)(F)F)C(F)(F)F.c1cn[nH]c1 |
| InChI | InChI=1S/C3H4N2.C2HF6NO4S2/c1-2-4-5-3-1;3-1(4,5)14(10,11)9-15(12,13)2(6,7)8/h1-3H,(H,4,5);9H |
| InChIKey | FYHUUDYCKWNUOI-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 108.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 349.23 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1H-pyrazole;1,1,1-trifluoro-N-(trifluoromethylsulfonyl)methanesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1H-pyrazole;1,1,1-trifluoro-N-(trifluoromethylsulfonyl)methanesulfonamide?
The IUPAC name of 1H-pyrazole;1,1,1-trifluoro-N-(trifluoromethylsulfonyl)methanesulfonamide (CID 171930364) is 1H-pyrazole;1,1,1-trifluoro-N-(trifluoromethylsulfonyl)methanesulfonamide.
What is the SMILES notation for 1H-pyrazole;1,1,1-trifluoro-N-(trifluoromethylsulfonyl)methanesulfonamide?
The canonical SMILES for 1H-pyrazole;1,1,1-trifluoro-N-(trifluoromethylsulfonyl)methanesulfonamide is O=S(=O)(NS(=O)(=O)C(F)(F)F)C(F)(F)F.c1cn[nH]c1.
What is the InChIKey of 1H-pyrazole;1,1,1-trifluoro-N-(trifluoromethylsulfonyl)methanesulfonamide?
The InChIKey is FYHUUDYCKWNUOI-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H4N2.C2HF6NO4S2/c1-2-4-5-3-1;3-1(4,5)14(10,11)9-15(12,13)2(6,7)8/h1-3H,(H,4,5);9H.
What are the key properties of 1H-pyrazole;1,1,1-trifluoro-N-(trifluoromethylsulfonyl)methanesulfonamide?
1H-pyrazole;1,1,1-trifluoro-N-(trifluoromethylsulfonyl)methanesulfonamide has a molecular weight of 349.23 g/mol, XLogP of 0.68, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1H-pyrazole;1,1,1-trifluoro-N-(trifluoromethylsulfonyl)methanesulfonamide is sourced from PubChem (CID 171930364), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).